About 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane
7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane (PubChem CID 12530025) has the molecular formula C19H20O2S
and a molecular weight of 312.43 g/mol. Its IUPAC name is 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| PubChem CID | 12530025 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane |
| SMILES | c1ccc(C2CC3(CC(c4ccccc4)S2)OCCO3)cc1 |
| InChI | InChI=1S/C19H20O2S/c1-3-7-15(8-4-1)17-13-19(20-11-12-21-19)14-18(22-17)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | BMYQLPSYOQQBKJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The IUPAC name of 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane (CID 12530025) is 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane.
What is the SMILES notation for 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The canonical SMILES for 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane is c1ccc(C2CC3(CC(c4ccccc4)S2)OCCO3)cc1.
What is the InChIKey of 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
The InChIKey is BMYQLPSYOQQBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2S/c1-3-7-15(8-4-1)17-13-19(20-11-12-21-19)14-18(22-17)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2.
What are the key properties of 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane?
7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane has a molecular weight of 312.43 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diphenyl-1,4-dioxa-8-thiaspiro[4.5]decane is sourced from PubChem (CID 12530025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).