C6H2F5NOS — CID 12530523
2,3,4,5,6-pentafluorobenzenesulfinamide (PubChem CID 12530523) has the molecular formula C6H2F5NOS and a molecular weight of 231.14 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenesulfinamide.
| Compound Name | 2,3,4,5,6-pentafluorobenzenesulfinamide |
|---|---|
| PubChem CID | 12530523 |
| Molecular Formula | C6H2F5NOS |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfinamide |
| SMILES | NS(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H2F5NOS/c7-1-2(8)4(10)6(14(12)13)5(11)3(1)9/h12H2 |
| InChIKey | YXJWSAWSNFCUAR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|