C5ClF7 — CID 12530560
3-chloro-1,2,3,4,4,5,5-heptafluorocyclopentene (PubChem CID 12530560) has the molecular formula C5ClF7 and a molecular weight of 228.49 g/mol. Its IUPAC name is 3-chloro-1,2,3,4,4,5,5-heptafluorocyclopentene.
| Compound Name | 3-chloro-1,2,3,4,4,5,5-heptafluorocyclopentene |
|---|---|
| PubChem CID | 12530560 |
| Molecular Formula | C5ClF7 |
| Molecular Weight | 228.49 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | 3-chloro-1,2,3,4,4,5,5-heptafluorocyclopentene |
| SMILES | FC1=C(F)C(F)(Cl)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5ClF7/c6-3(9)1(7)2(8)4(10,11)5(3,12)13 |
| InChIKey | MTXFJQPFMARORW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|