C8H15N2O3P — CID 12530625
2-ethoxy-1,3,6-trimethyl-2-oxo-1,3,2lambda5-diazaphosphinin-4-one (PubChem CID 12530625) has the molecular formula C8H15N2O3P and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-ethoxy-1,3,6-trimethyl-2-oxo-1,3,2lambda5-diazaphosphinin-4-one.
| Compound Name | 2-ethoxy-1,3,6-trimethyl-2-oxo-1,3,2lambda5-diazaphosphinin-4-one |
|---|---|
| PubChem CID | 12530625 |
| Molecular Formula | C8H15N2O3P |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-ethoxy-1,3,6-trimethyl-2-oxo-1,3,2lambda5-diazaphosphinin-4-one |
| SMILES | CCOP1(=O)N(C)C(=O)C=C(C)N1C |
| InChI | InChI=1S/C8H15N2O3P/c1-5-13-14(12)9(3)7(2)6-8(11)10(14)4/h6H,5H2,1-4H3 |
| InChIKey | TWJKGBMMVDHWAS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|