C14H25NO — CID 12530642
4-[(4E,6E)-2,6-dimethylocta-4,6-dien-3-yl]morpholine (PubChem CID 12530642) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-[(4E,6E)-2,6-dimethylocta-4,6-dien-3-yl]morpholine.
| Compound Name | 4-[(4E,6E)-2,6-dimethylocta-4,6-dien-3-yl]morpholine |
|---|---|
| PubChem CID | 12530642 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 4-[(4E,6E)-2,6-dimethylocta-4,6-dien-3-yl]morpholine |
| SMILES | C/C=C(C)/C=C/C(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C14H25NO/c1-5-13(4)6-7-14(12(2)3)15-8-10-16-11-9-15/h5-7,12,14H,8-11H2,1-4H3/b7-6+,13-5+ |
| InChIKey | PKJSRDWZGGNFMJ-KCFSHNHPSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|