C6H8N4 — CID 12531339
1,2,3,4-tetrahydropteridine (PubChem CID 12531339) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropteridine.
| Compound Name | 1,2,3,4-tetrahydropteridine |
|---|---|
| PubChem CID | 12531339 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1,2,3,4-tetrahydropteridine |
| SMILES | c1cnc2c(n1)CNCN2 |
| InChI | InChI=1S/C6H8N4/c1-2-9-6-5(8-1)3-7-4-10-6/h1-2,7H,3-4H2,(H,9,10) |
| InChIKey | BHLDFACEVDGQSV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |