About 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one
6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 12531628) has the molecular formula C12H12O4
and a molecular weight of 220.22 g/mol. Its IUPAC name is 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one |
| PubChem CID | 12531628 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | CC1(C)CC(=O)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C12H12O4/c1-12(2)5-8(13)7-3-10-11(15-6-14-10)4-9(7)16-12/h3-4H,5-6H2,1-2H3 |
| InChIKey | MOXBXXGPHQPQAA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one?
The IUPAC name of 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one (CID 12531628) is 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one.
What is the SMILES notation for 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one?
The canonical SMILES for 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one is CC1(C)CC(=O)c2cc3c(cc2O1)OCO3.
What is the InChIKey of 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one?
The InChIKey is MOXBXXGPHQPQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O4/c1-12(2)5-8(13)7-3-10-11(15-6-14-10)4-9(7)16-12/h3-4H,5-6H2,1-2H3.
What are the key properties of 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one?
6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one has a molecular weight of 220.22 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-7H-[1,3]dioxolo[4,5-g]chromen-8-one is sourced from PubChem (CID 12531628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).