About 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine
3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine (PubChem CID 12531796) has the molecular formula C14H6F7N3
and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 12531796 |
| Molecular Formula | C14H6F7N3 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Fc1ccc(-c2[nH]nc3nc(C(F)(F)F)cc(C(F)(F)F)c23)cc1 |
| InChI | InChI=1S/C14H6F7N3/c15-7-3-1-6(2-4-7)11-10-8(13(16,17)18)5-9(14(19,20)21)22-12(10)24-23-11/h1-5H,(H,22,23,24) |
| InChIKey | KGEXSCSONVNYHF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine (CID 12531796) is 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine is Fc1ccc(-c2[nH]nc3nc(C(F)(F)F)cc(C(F)(F)F)c23)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is KGEXSCSONVNYHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6F7N3/c15-7-3-1-6(2-4-7)11-10-8(13(16,17)18)5-9(14(19,20)21)22-12(10)24-23-11/h1-5H,(H,22,23,24).
What are the key properties of 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine?
3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 349.21 g/mol, XLogP of 4.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-4,6-bis(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 12531796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).