C22H22F2N4O2 — CID 125319217
ethyl N-[2,6-bis[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 125319217) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is ethyl N-[2,6-bis[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2,6-bis[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 125319217 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | ethyl N-[2,6-bis[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F2N4O2/c1-2-30-22(29)27-19-11-12-20(25-13-15-3-7-17(23)8-4-15)28-21(19)26-14-16-5-9-18(24)10-6-16/h3-12H,2,13-14H2,1H3,(H,27,29)(H2,25,26,28) |
| InChIKey | GSMOUEDCTAYAEN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |