C17H23N3O3 — CID 1253274
2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-4-nitrophenol (PubChem CID 1253274) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-4-nitrophenol.
| Compound Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 1253274 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/C[C@@H]2CCCN3CCCC[C@H]23)c1 |
| InChI | InChI=1S/C17H23N3O3/c21-17-7-6-15(20(22)23)10-14(17)12-18-11-13-4-3-9-19-8-2-1-5-16(13)19/h6-7,10,12-13,16,21H,1-5,8-9,11H2/b18-12+/t13-,16+/m0/s1 |
| InChIKey | LEVXMDULTLHBDO-KLFQZFQVSA-N |
| XLogP | 2.98 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|