About CID 12533260
CID 12533260 (PubChem CID 12533260) has the molecular formula C12H8F3OS+
and a molecular weight of 257.26 g/mol.
Molecular Properties
| Compound Name | CID 12533260 |
| PubChem CID | 12533260 |
| Molecular Formula | C12H8F3OS+ |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | — |
| SMILES | O=[S+](F)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H8F3OS/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H/q+1 |
| InChIKey | JTPWSAHKKAUKCL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 12533260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12533260?
The IUPAC name of CID 12533260 (CID 12533260) is not available.
What is the SMILES notation for CID 12533260?
The canonical SMILES for CID 12533260 is O=[S+](F)(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of CID 12533260?
The InChIKey is JTPWSAHKKAUKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3OS/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H/q+1.
What are the key properties of CID 12533260?
CID 12533260 has a molecular weight of 257.26 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12533260 is sourced from PubChem (CID 12533260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).