C29H43N3O2 — CID 125339644
(4S)-N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(2-methylpropyl)-1-oxospiro[4H-isoquinoline-3,1'-cyclohexane]-4-carboxamide (PubChem CID 125339644) has the molecular formula C29H43N3O2 and a molecular weight of 465.68 g/mol. Its IUPAC name is (4S)-N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(2-methylpropyl)-1-oxospiro[4H-isoquinoline-3,1'-cyclohexane]-4-carboxamide.
| Compound Name | (4S)-N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(2-methylpropyl)-1-oxospiro[4H-isoquinoline-3,1'-cyclohexane]-4-carboxamide |
|---|---|
| PubChem CID | 125339644 |
| Molecular Formula | C29H43N3O2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | (4S)-N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-(2-methylpropyl)-1-oxospiro[4H-isoquinoline-3,1'-cyclohexane]-4-carboxamide |
| SMILES | CC(C)CN1C(=O)c2ccccc2[C@H](C(=O)NC[C@H]2CCCN3CCCC[C@H]23)C12CCCCC2 |
| InChI | InChI=1S/C29H43N3O2/c1-21(2)20-32-28(34)24-13-5-4-12-23(24)26(29(32)15-7-3-8-16-29)27(33)30-19-22-11-10-18-31-17-9-6-14-25(22)31/h4-5,12-13,21-22,25-26H,3,6-11,14-20H2,1-2H3,(H,30,33)/t22-,25-,26-/m1/s1 |
| InChIKey | QYOCZGINUVALFF-DNRSQYFGSA-N |
| XLogP | 4.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |