C8H10O — CID 12534165
(1R,5R,6R)-6-ethenylbicyclo[3.1.0]hexan-2-one (PubChem CID 12534165) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is (1R,5R,6R)-6-ethenylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R,6R)-6-ethenylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 12534165 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (1R,5R,6R)-6-ethenylbicyclo[3.1.0]hexan-2-one |
| SMILES | C=C[C@@H]1[C@H]2CCC(=O)[C@@H]12 |
| InChI | InChI=1S/C8H10O/c1-2-5-6-3-4-7(9)8(5)6/h2,5-6,8H,1,3-4H2/t5-,6-,8+/m1/s1 |
| InChIKey | IJGPTRGYEZQWQS-JKMUOGBPSA-N |
| XLogP | 1.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|