About pentanethioamide
pentanethioamide (PubChem CID 12534254) has the molecular formula C5H11NS
and a molecular weight of 117.22 g/mol. Its IUPAC name is pentanethioamide.
Molecular Properties
| Compound Name | pentanethioamide |
| PubChem CID | 12534254 |
| Molecular Formula | C5H11NS |
| Molecular Weight | 117.22 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | pentanethioamide |
| SMILES | CCCCC(N)=S |
| InChI | InChI=1S/C5H11NS/c1-2-3-4-5(6)7/h2-4H2,1H3,(H2,6,7) |
| InChIKey | FFXIGVUMVPUWDK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanethioamide?
The IUPAC name of pentanethioamide (CID 12534254) is pentanethioamide.
What is the SMILES notation for pentanethioamide?
The canonical SMILES for pentanethioamide is CCCCC(N)=S.
What is the InChIKey of pentanethioamide?
The InChIKey is FFXIGVUMVPUWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS/c1-2-3-4-5(6)7/h2-4H2,1H3,(H2,6,7).
What are the key properties of pentanethioamide?
pentanethioamide has a molecular weight of 117.22 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanethioamide is sourced from PubChem (CID 12534254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).