About [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol
[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol (PubChem CID 12534279) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol.
Molecular Properties
| Compound Name | [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol |
| PubChem CID | 12534279 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol |
| SMILES | OC[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C8H14O/c9-5-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2/t6-,7+,8+/m0/s1 |
| InChIKey | LWHKUVOYICRGGR-XLPZGREQSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol?
The IUPAC name of [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol (CID 12534279) is [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol.
What is the SMILES notation for [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol?
The canonical SMILES for [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol is OC[C@H]1C[C@H]2CC[C@@H]1C2.
What is the InChIKey of [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol?
The InChIKey is LWHKUVOYICRGGR-XLPZGREQSA-N. The full InChI is InChI=1S/C8H14O/c9-5-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2/t6-,7+,8+/m0/s1.
What are the key properties of [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol?
[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol has a molecular weight of 126.20 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methanol is sourced from PubChem (CID 12534279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).