C28H40F6O2Si2 — CID 12534368
triethyl-(1,1,1,4,4,4-hexafluoro-2,3-diphenyl-3-triethylsilyloxybutan-2-yl)oxysilane (PubChem CID 12534368) has the molecular formula C28H40F6O2Si2 and a molecular weight of 578.79 g/mol. Its IUPAC name is triethyl-(1,1,1,4,4,4-hexafluoro-2,3-diphenyl-3-triethylsilyloxybutan-2-yl)oxysilane.
| Compound Name | triethyl-(1,1,1,4,4,4-hexafluoro-2,3-diphenyl-3-triethylsilyloxybutan-2-yl)oxysilane |
|---|---|
| PubChem CID | 12534368 |
| Molecular Formula | C28H40F6O2Si2 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | triethyl-(1,1,1,4,4,4-hexafluoro-2,3-diphenyl-3-triethylsilyloxybutan-2-yl)oxysilane |
| SMILES | CC[Si](CC)(CC)OC(c1ccccc1)(C(F)(F)F)C(O[Si](CC)(CC)CC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H40F6O2Si2/c1-7-37(8-2,9-3)35-25(27(29,30)31,23-19-15-13-16-20-23)26(28(32,33)34,24-21-17-14-18-22-24)36-38(10-4,11-5)12-6/h13-22H,7-12H2,1-6H3 |
| InChIKey | HUSUDZDRJKUVPF-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|