About 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine
3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine (PubChem CID 12535574) has the molecular formula C10H10N4S
and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine |
| PubChem CID | 12535574 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine |
| SMILES | CSc1nnc(-c2ccc(C)cc2)nn1 |
| InChI | InChI=1S/C10H10N4S/c1-7-3-5-8(6-4-7)9-11-13-10(15-2)14-12-9/h3-6H,1-2H3 |
| InChIKey | QIRRQTRPEKOKHS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine?
The IUPAC name of 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine (CID 12535574) is 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine?
The canonical SMILES for 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine is CSc1nnc(-c2ccc(C)cc2)nn1.
What is the InChIKey of 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine?
The InChIKey is QIRRQTRPEKOKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4S/c1-7-3-5-8(6-4-7)9-11-13-10(15-2)14-12-9/h3-6H,1-2H3.
What are the key properties of 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine?
3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine has a molecular weight of 218.28 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-6-methylsulfanyl-1,2,4,5-tetrazine is sourced from PubChem (CID 12535574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).