C15H16N2O3S — CID 12535811
ethyl 2-(2-ethylsulfanylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 12535811) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is ethyl 2-(2-ethylsulfanylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(2-ethylsulfanylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 12535811 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | ethyl 2-(2-ethylsulfanylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2SCC)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O3S/c1-3-20-15(19)11-9-16-13(17-14(11)18)10-7-5-6-8-12(10)21-4-2/h5-9H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | OEFNZGBOLBRGIB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |