C11H7ClN2O3 — CID 12535857
2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 12535857) has the molecular formula C11H7ClN2O3 and a molecular weight of 250.64 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 12535857 |
| Molecular Formula | C11H7ClN2O3 |
| Molecular Weight | 250.64 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-(4-chlorophenyl)-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C11H7ClN2O3/c12-7-3-1-6(2-4-7)9-13-5-8(11(16)17)10(15)14-9/h1-5H,(H,16,17)(H,13,14,15) |
| InChIKey | PGNZPCAAYIFNRG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.64 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |