About 2,3-diethoxy-1,4-dioxane
2,3-diethoxy-1,4-dioxane (PubChem CID 12536103) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2,3-diethoxy-1,4-dioxane.
Molecular Properties
| Compound Name | 2,3-diethoxy-1,4-dioxane |
| PubChem CID | 12536103 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2,3-diethoxy-1,4-dioxane |
| SMILES | CCOC1OCCOC1OCC |
| InChI | InChI=1S/C8H16O4/c1-3-9-7-8(10-4-2)12-6-5-11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | VDIKXUVXTWMNQI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-diethoxy-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethoxy-1,4-dioxane?
The IUPAC name of 2,3-diethoxy-1,4-dioxane (CID 12536103) is 2,3-diethoxy-1,4-dioxane.
What is the SMILES notation for 2,3-diethoxy-1,4-dioxane?
The canonical SMILES for 2,3-diethoxy-1,4-dioxane is CCOC1OCCOC1OCC.
What is the InChIKey of 2,3-diethoxy-1,4-dioxane?
The InChIKey is VDIKXUVXTWMNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-3-9-7-8(10-4-2)12-6-5-11-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,3-diethoxy-1,4-dioxane?
2,3-diethoxy-1,4-dioxane has a molecular weight of 176.21 g/mol, XLogP of 0.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethoxy-1,4-dioxane is sourced from PubChem (CID 12536103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).