About 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol
2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol (PubChem CID 12536602) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol |
| PubChem CID | 12536602 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(CNCc2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/C18H23NO2/c1-11-5-13(3)17(20)15(7-11)9-19-10-16-8-12(2)6-14(4)18(16)21/h5-8,19-21H,9-10H2,1-4H3 |
| InChIKey | BPDCFBLYJYVZKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol?
The IUPAC name of 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol (CID 12536602) is 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol.
What is the SMILES notation for 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol?
The canonical SMILES for 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol is Cc1cc(C)c(O)c(CNCc2cc(C)cc(C)c2O)c1.
What is the InChIKey of 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol?
The InChIKey is BPDCFBLYJYVZKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c1-11-5-13(3)17(20)15(7-11)9-19-10-16-8-12(2)6-14(4)18(16)21/h5-8,19-21H,9-10H2,1-4H3.
What are the key properties of 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol?
2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol has a molecular weight of 285.39 g/mol, XLogP of 3.62, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2-hydroxy-3,5-dimethylphenyl)methylamino]methyl]-4,6-dimethylphenol is sourced from PubChem (CID 12536602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).