About 3-chloro-2-methyloxane
3-chloro-2-methyloxane (PubChem CID 12536720) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is 3-chloro-2-methyloxane.
Molecular Properties
| Compound Name | 3-chloro-2-methyloxane |
| PubChem CID | 12536720 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 3-chloro-2-methyloxane |
| SMILES | CC1OCCCC1Cl |
| InChI | InChI=1S/C6H11ClO/c1-5-6(7)3-2-4-8-5/h5-6H,2-4H2,1H3 |
| InChIKey | SOYDWGXULTWHLQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methyloxane?
The IUPAC name of 3-chloro-2-methyloxane (CID 12536720) is 3-chloro-2-methyloxane.
What is the SMILES notation for 3-chloro-2-methyloxane?
The canonical SMILES for 3-chloro-2-methyloxane is CC1OCCCC1Cl.
What is the InChIKey of 3-chloro-2-methyloxane?
The InChIKey is SOYDWGXULTWHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO/c1-5-6(7)3-2-4-8-5/h5-6H,2-4H2,1H3.
What are the key properties of 3-chloro-2-methyloxane?
3-chloro-2-methyloxane has a molecular weight of 134.61 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methyloxane is sourced from PubChem (CID 12536720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).