About 6,6-dimethyl-2,5-dihydropyran
6,6-dimethyl-2,5-dihydropyran (PubChem CID 12536733) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is 6,6-dimethyl-2,5-dihydropyran.
Molecular Properties
| Compound Name | 6,6-dimethyl-2,5-dihydropyran |
| PubChem CID | 12536733 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 6,6-dimethyl-2,5-dihydropyran |
| SMILES | CC1(C)CC=CCO1 |
| InChI | InChI=1S/C7H12O/c1-7(2)5-3-4-6-8-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | XGHIDMPJYHSIGN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-2,5-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2,5-dihydropyran?
The IUPAC name of 6,6-dimethyl-2,5-dihydropyran (CID 12536733) is 6,6-dimethyl-2,5-dihydropyran.
What is the SMILES notation for 6,6-dimethyl-2,5-dihydropyran?
The canonical SMILES for 6,6-dimethyl-2,5-dihydropyran is CC1(C)CC=CCO1.
What is the InChIKey of 6,6-dimethyl-2,5-dihydropyran?
The InChIKey is XGHIDMPJYHSIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O/c1-7(2)5-3-4-6-8-7/h3-4H,5-6H2,1-2H3.
What are the key properties of 6,6-dimethyl-2,5-dihydropyran?
6,6-dimethyl-2,5-dihydropyran has a molecular weight of 112.17 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2,5-dihydropyran is sourced from PubChem (CID 12536733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).