C8H8Cl4 — CID 12536814
4,4,8,8-tetrachlorotricyclo[5.1.0.03,5]octane (PubChem CID 12536814) has the molecular formula C8H8Cl4 and a molecular weight of 245.96 g/mol. Its IUPAC name is 4,4,8,8-tetrachlorotricyclo[5.1.0.03,5]octane.
| Compound Name | 4,4,8,8-tetrachlorotricyclo[5.1.0.03,5]octane |
|---|---|
| PubChem CID | 12536814 |
| Molecular Formula | C8H8Cl4 |
| Molecular Weight | 245.96 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 4,4,8,8-tetrachlorotricyclo[5.1.0.03,5]octane |
| SMILES | ClC1(Cl)C2CC3C(CC21)C3(Cl)Cl |
| InChI | InChI=1S/C8H8Cl4/c9-7(10)3-1-4-6(2-5(3)7)8(4,11)12/h3-6H,1-2H2 |
| InChIKey | XITQFTQFRMDRMD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|