C9H18 — CID 12536912
(1S,2S,4R)-1,2,4-trimethylcyclohexane (PubChem CID 12536912) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is (1S,2S,4R)-1,2,4-trimethylcyclohexane.
| Compound Name | (1S,2S,4R)-1,2,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 12536912 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | (1S,2S,4R)-1,2,4-trimethylcyclohexane |
| SMILES | C[C@@H]1CC[C@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C9H18/c1-7-4-5-8(2)9(3)6-7/h7-9H,4-6H2,1-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | VCJPCEVERINRSG-VGMNWLOBSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |