C11H16 — CID 12536961
(1E,5Z)-1-cyclopropylcycloocta-1,5-diene (PubChem CID 12536961) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1E,5Z)-1-cyclopropylcycloocta-1,5-diene.
| Compound Name | (1E,5Z)-1-cyclopropylcycloocta-1,5-diene |
|---|---|
| PubChem CID | 12536961 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1E,5Z)-1-cyclopropylcycloocta-1,5-diene |
| SMILES | C1=C\CC/C(C2CC2)=C\CC/1 |
| InChI | InChI=1S/C11H16/c1-2-4-6-10(7-5-3-1)11-8-9-11/h1-2,7,11H,3-6,8-9H2/b2-1-,10-7+ |
| InChIKey | CZNXQALXNGTTHW-PLKBPYKHSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|