C15H18Cl2N2O — CID 125370734
[(1S)-2,2-dichloro-1-methylcyclopropyl]-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone (PubChem CID 125370734) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is [(1S)-2,2-dichloro-1-methylcyclopropyl]-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone.
| Compound Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone |
|---|---|
| PubChem CID | 125370734 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-[(2S,4S)-3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]methanone |
| SMILES | Cc1nn(C(=O)[C@]2(C)CC2(Cl)Cl)c2c1[C@H]1[C@H](C2)C1(C)C |
| InChI | InChI=1S/C15H18Cl2N2O/c1-7-10-9(5-8-11(10)13(8,2)3)19(18-7)12(20)14(4)6-15(14,16)17/h8,11H,5-6H2,1-4H3/t8-,11+,14-/m0/s1 |
| InChIKey | MCUSISQBVWANQN-UPLXVJCVSA-N |
| XLogP | 3.71 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|