About 1,2,3-trimethylcyclohexene
1,2,3-trimethylcyclohexene (PubChem CID 12537123) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 1,2,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | 1,2,3-trimethylcyclohexene |
| PubChem CID | 12537123 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 1,2,3-trimethylcyclohexene |
| SMILES | CC1=C(C)C(C)CCC1 |
| InChI | InChI=1S/C9H16/c1-7-5-4-6-8(2)9(7)3/h7H,4-6H2,1-3H3 |
| InChIKey | WCXPIAKENXAPPI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethylcyclohexene?
The IUPAC name of 1,2,3-trimethylcyclohexene (CID 12537123) is 1,2,3-trimethylcyclohexene.
What is the SMILES notation for 1,2,3-trimethylcyclohexene?
The canonical SMILES for 1,2,3-trimethylcyclohexene is CC1=C(C)C(C)CCC1.
What is the InChIKey of 1,2,3-trimethylcyclohexene?
The InChIKey is WCXPIAKENXAPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-7-5-4-6-8(2)9(7)3/h7H,4-6H2,1-3H3.
What are the key properties of 1,2,3-trimethylcyclohexene?
1,2,3-trimethylcyclohexene has a molecular weight of 124.23 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylcyclohexene is sourced from PubChem (CID 12537123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).