2,2-diethyl-3,3-dimethylbutanoic acid

C10H20O2 — CID 12537174

IUPAC2,2-diethyl-3,3-dimethylbutanoic acid
SMILESCCC(CC)(C(=O)O)C(C)(C)C
InChIInChI=1S/C10H20O2/c1-6-10(7-2,8(11)12)9(3,4)5/h6-7H2,1-5H3,(H,11,12)
InChIKeyIAZOGAJAUIVBNO-UHFFFAOYSA-N
MW172.27 g/mol
LogP2.92
Rot. Bonds3

About 2,2-diethyl-3,3-dimethylbutanoic acid

2,2-diethyl-3,3-dimethylbutanoic acid (PubChem CID 12537174) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,2-diethyl-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name2,2-diethyl-3,3-dimethylbutanoic acid
PubChem CID12537174
Molecular FormulaC10H20O2
Molecular Weight172.27 g/mol
Exact Mass172.15
IUPAC Name2,2-diethyl-3,3-dimethylbutanoic acid
SMILESCCC(CC)(C(=O)O)C(C)(C)C
InChIInChI=1S/C10H20O2/c1-6-10(7-2,8(11)12)9(3,4)5/h6-7H2,1-5H3,(H,11,12)
InChIKeyIAZOGAJAUIVBNO-UHFFFAOYSA-N
XLogP2.92
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.27
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-diethyl-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-diethyl-3,3-dimethylbutanoic acid?
The IUPAC name of 2,2-diethyl-3,3-dimethylbutanoic acid (CID 12537174) is 2,2-diethyl-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2,2-diethyl-3,3-dimethylbutanoic acid?
The canonical SMILES for 2,2-diethyl-3,3-dimethylbutanoic acid is CCC(CC)(C(=O)O)C(C)(C)C.
What is the InChIKey of 2,2-diethyl-3,3-dimethylbutanoic acid?
The InChIKey is IAZOGAJAUIVBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-6-10(7-2,8(11)12)9(3,4)5/h6-7H2,1-5H3,(H,11,12).
What are the key properties of 2,2-diethyl-3,3-dimethylbutanoic acid?
2,2-diethyl-3,3-dimethylbutanoic acid has a molecular weight of 172.27 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-3,3-dimethylbutanoic acid is sourced from PubChem (CID 12537174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).