C29H16F6N2O2 — CID 12537785
2-[4-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 12537785) has the molecular formula C29H16F6N2O2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 2-[4-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 12537785 |
| Molecular Formula | C29H16F6N2O2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 2-[4-[2-[4-(1,3-benzoxazol-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | FC(F)(F)C(c1ccc(-c2nc3ccccc3o2)cc1)(c1ccc(-c2nc3ccccc3o2)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H16F6N2O2/c30-28(31,32)27(29(33,34)35,19-13-9-17(10-14-19)25-36-21-5-1-3-7-23(21)38-25)20-15-11-18(12-16-20)26-37-22-6-2-4-8-24(22)39-26/h1-16H |
| InChIKey | MEWJBHOJADHCJW-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |