C8H12O4 — CID 12538215
(1Z,3Z)-5,8-dihydroperoxycycloocta-1,3-diene (PubChem CID 12538215) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (1Z,3Z)-5,8-dihydroperoxycycloocta-1,3-diene.
| Compound Name | (1Z,3Z)-5,8-dihydroperoxycycloocta-1,3-diene |
|---|---|
| PubChem CID | 12538215 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1Z,3Z)-5,8-dihydroperoxycycloocta-1,3-diene |
| SMILES | OOC1/C=C\C=C/C(OO)CC1 |
| InChI | InChI=1S/C8H12O4/c9-11-7-3-1-2-4-8(12-10)6-5-7/h1-4,7-10H,5-6H2/b3-1-,4-2- |
| InChIKey | PIBIVIAZZIKTQQ-CCAGOZQPSA-N |
| XLogP | 1.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|