C18H22FN9O2 — CID 125385732
N-[(3S,4S)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 125385732) has the molecular formula C18H22FN9O2 and a molecular weight of 415.43 g/mol. Its IUPAC name is N-[(3S,4S)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 125385732 |
| Molecular Formula | C18H22FN9O2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(3S,4S)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(c2nc(Nc3cn(C)nc3OC)c3ncn(C)c3n2)C[C@@H]1F |
| InChI | InChI=1S/C18H22FN9O2/c1-5-13(29)21-11-8-28(6-10(11)19)18-23-15(14-16(24-18)26(2)9-20-14)22-12-7-27(3)25-17(12)30-4/h5,7,9-11H,1,6,8H2,2-4H3,(H,21,29)(H,22,23,24)/t10-,11-/m0/s1 |
| InChIKey | JYIUNVOCEFIUIU-QWRGUYRKSA-N |
| XLogP | 0.68 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|