C23H25N3O6 — CID 1253864
[4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl-propan-2-ylcarbamoyl]phenyl] acetate (PubChem CID 1253864) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is [4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl-propan-2-ylcarbamoyl]phenyl] acetate.
| Compound Name | [4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl-propan-2-ylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 1253864 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl-propan-2-ylcarbamoyl]phenyl] acetate |
| SMILES | COc1ccc(-c2noc(CN(C(=O)c3ccc(OC(C)=O)cc3)C(C)C)n2)cc1OC |
| InChI | InChI=1S/C23H25N3O6/c1-14(2)26(23(28)16-6-9-18(10-7-16)31-15(3)27)13-21-24-22(25-32-21)17-8-11-19(29-4)20(12-17)30-5/h6-12,14H,13H2,1-5H3 |
| InChIKey | FLDXMPBOQKSGES-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|