C12H10N2O6 — CID 125386866
methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate (PubChem CID 125386866) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 125386866 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1conc1[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N2O6/c1-19-12(16)9-6-20-13-10(9)11(15)7-2-4-8(5-3-7)14(17)18/h2-6,11,15H,1H3/t11-/m0/s1 |
| InChIKey | LHIIEOGWOZGKCR-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|