About methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate
methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate (PubChem CID 125386866) has the molecular formula C12H10N2O6
and a molecular weight of 278.22 g/mol. Its IUPAC name is methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate |
| PubChem CID | 125386866 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1conc1[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N2O6/c1-19-12(16)9-6-20-13-10(9)11(15)7-2-4-8(5-3-7)14(17)18/h2-6,11,15H,1H3/t11-/m0/s1 |
| InChIKey | LHIIEOGWOZGKCR-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate (CID 125386866) is methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate is COC(=O)c1conc1[C@@H](O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate?
The InChIKey is LHIIEOGWOZGKCR-NSHDSACASA-N. The full InChI is InChI=1S/C12H10N2O6/c1-19-12(16)9-6-20-13-10(9)11(15)7-2-4-8(5-3-7)14(17)18/h2-6,11,15H,1H3/t11-/m0/s1.
What are the key properties of methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate?
methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate has a molecular weight of 278.22 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(S)-hydroxy-(4-nitrophenyl)methyl]-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 125386866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).