About 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one
3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one (PubChem CID 1253890) has the molecular formula C24H24N2O
and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one |
| PubChem CID | 1253890 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one |
| SMILES | C=CCc1nc2c(c(=O)n1Cc1ccccc1)C(C)(C)Cc1ccccc1-2 |
| InChI | InChI=1S/C24H24N2O/c1-4-10-20-25-22-19-14-9-8-13-18(19)15-24(2,3)21(22)23(27)26(20)16-17-11-6-5-7-12-17/h4-9,11-14H,1,10,15-16H2,2-3H3 |
| InChIKey | GOGPMPBDFJLIMK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one?
The IUPAC name of 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one (CID 1253890) is 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one.
What is the SMILES notation for 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one?
The canonical SMILES for 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one is C=CCc1nc2c(c(=O)n1Cc1ccccc1)C(C)(C)Cc1ccccc1-2.
What is the InChIKey of 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one?
The InChIKey is GOGPMPBDFJLIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O/c1-4-10-20-25-22-19-14-9-8-13-18(19)15-24(2,3)21(22)23(27)26(20)16-17-11-6-5-7-12-17/h4-9,11-14H,1,10,15-16H2,2-3H3.
What are the key properties of 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one?
3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one has a molecular weight of 356.47 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5,5-dimethyl-2-prop-2-enyl-6H-benzo[h]quinazolin-4-one is sourced from PubChem (CID 1253890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).