C16H14BrNOS — CID 12539171
2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)-1-phenylethanone bromide (PubChem CID 12539171) has the molecular formula C16H14BrNOS and a molecular weight of 348.27 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)-1-phenylethanone bromide.
| Compound Name | 2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)-1-phenylethanone bromide |
|---|---|
| PubChem CID | 12539171 |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-(2-methyl-1,3-benzothiazol-3-ium-3-yl)-1-phenylethanone bromide |
| SMILES | Cc1sc2ccccc2[n+]1CC(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C16H14NOS.BrH/c1-12-17(14-9-5-6-10-16(14)19-12)11-15(18)13-7-3-2-4-8-13;/h2-10H,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | UBZUGODTEUOBAO-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|