(E)-3-methylpent-3-enoic acid

C6H10O2 — CID 12539592

IUPAC(E)-3-methylpent-3-enoic acid
SMILESC/C=C(\C)CC(=O)O
InChIInChI=1S/C6H10O2/c1-3-5(2)4-6(7)8/h3H,4H2,1-2H3,(H,7,8)/b5-3+
InChIKeyOGVROELYPSGUQB-HWKANZROSA-N
MW114.14 g/mol
LogP1.43
Rot. Bonds2

About (E)-3-methylpent-3-enoic acid

(E)-3-methylpent-3-enoic acid (PubChem CID 12539592) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (E)-3-methylpent-3-enoic acid.

Molecular Properties

Compound Name(E)-3-methylpent-3-enoic acid
PubChem CID12539592
Molecular FormulaC6H10O2
Molecular Weight114.14 g/mol
Exact Mass114.07
IUPAC Name(E)-3-methylpent-3-enoic acid
SMILESC/C=C(\C)CC(=O)O
InChIInChI=1S/C6H10O2/c1-3-5(2)4-6(7)8/h3H,4H2,1-2H3,(H,7,8)/b5-3+
InChIKeyOGVROELYPSGUQB-HWKANZROSA-N
XLogP1.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.14
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-3-methylpent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-methylpent-3-enoic acid?
The IUPAC name of (E)-3-methylpent-3-enoic acid (CID 12539592) is (E)-3-methylpent-3-enoic acid.
What is the SMILES notation for (E)-3-methylpent-3-enoic acid?
The canonical SMILES for (E)-3-methylpent-3-enoic acid is C/C=C(\C)CC(=O)O.
What is the InChIKey of (E)-3-methylpent-3-enoic acid?
The InChIKey is OGVROELYPSGUQB-HWKANZROSA-N. The full InChI is InChI=1S/C6H10O2/c1-3-5(2)4-6(7)8/h3H,4H2,1-2H3,(H,7,8)/b5-3+.
What are the key properties of (E)-3-methylpent-3-enoic acid?
(E)-3-methylpent-3-enoic acid has a molecular weight of 114.14 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methylpent-3-enoic acid is sourced from PubChem (CID 12539592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).