About 2-diethoxyphosphoryl-N,2-diphenylethenimine
2-diethoxyphosphoryl-N,2-diphenylethenimine (PubChem CID 12539599) has the molecular formula C18H20NO3P
and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N,2-diphenylethenimine.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-N,2-diphenylethenimine |
| PubChem CID | 12539599 |
| Molecular Formula | C18H20NO3P |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-diethoxyphosphoryl-N,2-diphenylethenimine |
| SMILES | CCOP(=O)(OCC)C(=C=Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20NO3P/c1-3-21-23(20,22-4-2)18(16-11-7-5-8-12-16)15-19-17-13-9-6-10-14-17/h5-14H,3-4H2,1-2H3 |
| InChIKey | RJSFHSXRSSCRGJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-N,2-diphenylethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-N,2-diphenylethenimine?
The IUPAC name of 2-diethoxyphosphoryl-N,2-diphenylethenimine (CID 12539599) is 2-diethoxyphosphoryl-N,2-diphenylethenimine.
What is the SMILES notation for 2-diethoxyphosphoryl-N,2-diphenylethenimine?
The canonical SMILES for 2-diethoxyphosphoryl-N,2-diphenylethenimine is CCOP(=O)(OCC)C(=C=Nc1ccccc1)c1ccccc1.
What is the InChIKey of 2-diethoxyphosphoryl-N,2-diphenylethenimine?
The InChIKey is RJSFHSXRSSCRGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20NO3P/c1-3-21-23(20,22-4-2)18(16-11-7-5-8-12-16)15-19-17-13-9-6-10-14-17/h5-14H,3-4H2,1-2H3.
What are the key properties of 2-diethoxyphosphoryl-N,2-diphenylethenimine?
2-diethoxyphosphoryl-N,2-diphenylethenimine has a molecular weight of 329.34 g/mol, XLogP of 5.30, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-N,2-diphenylethenimine is sourced from PubChem (CID 12539599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).