C20H27NO5S — CID 125399323
ethyl (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylate (PubChem CID 125399323) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is ethyl (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 125399323 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@]2(C)C(=O)CCCC[C@@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NO5S/c1-4-26-19(23)16-13-20(3)17(7-5-6-8-18(20)22)21(16)27(24,25)15-11-9-14(2)10-12-15/h9-12,16-17H,4-8,13H2,1-3H3/t16-,17-,20-/m0/s1 |
| InChIKey | LKQRJDNQXYKHIT-ZWOKBUDYSA-N |
| XLogP | 2.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |