About diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate
diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate (PubChem CID 12540849) has the molecular formula C12H10F10O4
and a molecular weight of 408.19 g/mol. Its IUPAC name is diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate.
Molecular Properties
| Compound Name | diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate |
| PubChem CID | 12540849 |
| Molecular Formula | C12H10F10O4 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate |
| SMILES | CCOC(=O)/C(=C(/F)C(C(=O)OCC)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F10O4/c1-3-25-7(23)5(10(14,15)16)6(13)9(11(17,18)19,12(20,21)22)8(24)26-4-2/h3-4H2,1-2H3/b6-5- |
| InChIKey | NIVVTMHVECIUPH-WAYWQWQTSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate?
The IUPAC name of diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate (CID 12540849) is diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate.
What is the SMILES notation for diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate?
The canonical SMILES for diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate is CCOC(=O)/C(=C(/F)C(C(=O)OCC)(C(F)(F)F)C(F)(F)F)C(F)(F)F.
What is the InChIKey of diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate?
The InChIKey is NIVVTMHVECIUPH-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H10F10O4/c1-3-25-7(23)5(10(14,15)16)6(13)9(11(17,18)19,12(20,21)22)8(24)26-4-2/h3-4H2,1-2H3/b6-5-.
What are the key properties of diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate?
diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate has a molecular weight of 408.19 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-3-fluoro-2,4,4-tris(trifluoromethyl)pent-2-enedioate is sourced from PubChem (CID 12540849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).