About ethyl (Z)-2-aminohex-2-enoate
ethyl (Z)-2-aminohex-2-enoate (PubChem CID 12541123) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is ethyl (Z)-2-aminohex-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-2-aminohex-2-enoate |
| PubChem CID | 12541123 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | ethyl (Z)-2-aminohex-2-enoate |
| SMILES | CCC/C=C(\N)C(=O)OCC |
| InChI | InChI=1S/C8H15NO2/c1-3-5-6-7(9)8(10)11-4-2/h6H,3-5,9H2,1-2H3/b7-6- |
| InChIKey | DYQMTOXEOYQBOT-SREVYHEPSA-N |
| XLogP | 1.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-2-aminohex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-2-aminohex-2-enoate?
The IUPAC name of ethyl (Z)-2-aminohex-2-enoate (CID 12541123) is ethyl (Z)-2-aminohex-2-enoate.
What is the SMILES notation for ethyl (Z)-2-aminohex-2-enoate?
The canonical SMILES for ethyl (Z)-2-aminohex-2-enoate is CCC/C=C(\N)C(=O)OCC.
What is the InChIKey of ethyl (Z)-2-aminohex-2-enoate?
The InChIKey is DYQMTOXEOYQBOT-SREVYHEPSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-5-6-7(9)8(10)11-4-2/h6H,3-5,9H2,1-2H3/b7-6-.
What are the key properties of ethyl (Z)-2-aminohex-2-enoate?
ethyl (Z)-2-aminohex-2-enoate has a molecular weight of 157.21 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-2-aminohex-2-enoate is sourced from PubChem (CID 12541123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).