About 1,1,5-trichloropentane
1,1,5-trichloropentane (PubChem CID 12541128) has the molecular formula C5H9Cl3
and a molecular weight of 175.49 g/mol. Its IUPAC name is 1,1,5-trichloropentane.
Molecular Properties
| Compound Name | 1,1,5-trichloropentane |
| PubChem CID | 12541128 |
| Molecular Formula | C5H9Cl3 |
| Molecular Weight | 175.49 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 1,1,5-trichloropentane |
| SMILES | ClCCCCC(Cl)Cl |
| InChI | InChI=1S/C5H9Cl3/c6-4-2-1-3-5(7)8/h5H,1-4H2 |
| InChIKey | PFKLDGNDUZQYMM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,5-trichloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,5-trichloropentane?
The IUPAC name of 1,1,5-trichloropentane (CID 12541128) is 1,1,5-trichloropentane.
What is the SMILES notation for 1,1,5-trichloropentane?
The canonical SMILES for 1,1,5-trichloropentane is ClCCCCC(Cl)Cl.
What is the InChIKey of 1,1,5-trichloropentane?
The InChIKey is PFKLDGNDUZQYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Cl3/c6-4-2-1-3-5(7)8/h5H,1-4H2.
What are the key properties of 1,1,5-trichloropentane?
1,1,5-trichloropentane has a molecular weight of 175.49 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,5-trichloropentane is sourced from PubChem (CID 12541128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).