C27H38N2O9 — CID 12541326
N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]hexanamide;oxalic acid (PubChem CID 12541326) has the molecular formula C27H38N2O9 and a molecular weight of 534.61 g/mol. Its IUPAC name is N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]hexanamide;oxalic acid.
| Compound Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]hexanamide;oxalic acid |
|---|---|
| PubChem CID | 12541326 |
| Molecular Formula | C27H38N2O9 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]hexanamide;oxalic acid |
| SMILES | CCCCCC(=O)Nc1ccc(OCC(O)CNCCc2ccc(OC)c(OC)c2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H36N2O5.C2H2O4/c1-4-5-6-7-25(29)27-20-9-11-22(12-10-20)32-18-21(28)17-26-15-14-19-8-13-23(30-2)24(16-19)31-3;3-1(4)2(5)6/h8-13,16,21,26,28H,4-7,14-15,17-18H2,1-3H3,(H,27,29);(H,3,4)(H,5,6) |
| InChIKey | ASEOCMJZPNWOAL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|