C14H27BO2 — CID 125415623
(3aS,4R,6S,7aR)-4,5,5,6-tetramethyl-2-(2-methylpropyl)-4,6,7,7a-tetrahydro-3aH-benzo[d][1,3,2]dioxaborole (PubChem CID 125415623) has the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. Its IUPAC name is (3aS,4R,6S,7aR)-4,5,5,6-tetramethyl-2-(2-methylpropyl)-4,6,7,7a-tetrahydro-3aH-benzo[d][1,3,2]dioxaborole.
| Compound Name | (3aS,4R,6S,7aR)-4,5,5,6-tetramethyl-2-(2-methylpropyl)-4,6,7,7a-tetrahydro-3aH-benzo[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 125415623 |
| Molecular Formula | C14H27BO2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | (3aS,4R,6S,7aR)-4,5,5,6-tetramethyl-2-(2-methylpropyl)-4,6,7,7a-tetrahydro-3aH-benzo[d][1,3,2]dioxaborole |
| SMILES | CC(C)CB1O[C@@H]2[C@@H](C[C@H](C)C(C)(C)[C@H]2C)O1 |
| InChI | InChI=1S/C14H27BO2/c1-9(2)8-15-16-12-7-10(3)14(5,6)11(4)13(12)17-15/h9-13H,7-8H2,1-6H3/t10-,11-,12+,13-/m0/s1 |
| InChIKey | FSLHRFDKZYYZFA-RVMXOQNASA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|