C16H22F2N2O3 — CID 125417495
(2S,3R,4S)-2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol (PubChem CID 125417495) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2S,3R,4S)-2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol.
| Compound Name | (2S,3R,4S)-2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol |
|---|---|
| PubChem CID | 125417495 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2S,3R,4S)-2-[(3,3-difluoropyrrolidin-1-yl)methyl]-4-[(2-hydroxyphenyl)methylamino]oxolan-3-ol |
| SMILES | Oc1ccccc1CN[C@H]1CO[C@@H](CN2CCC(F)(F)C2)[C@@H]1O |
| InChI | InChI=1S/C16H22F2N2O3/c17-16(18)5-6-20(10-16)8-14-15(22)12(9-23-14)19-7-11-3-1-2-4-13(11)21/h1-4,12,14-15,19,21-22H,5-10H2/t12-,14-,15+/m0/s1 |
| InChIKey | WLAXFJNVCPAIKE-AEGPPILISA-N |
| XLogP | 0.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|