C24H28F2N2O2 — CID 125418330
(3aR,10aS)-8-(2,4-difluorophenyl)-2-hexyl-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one (PubChem CID 125418330) has the molecular formula C24H28F2N2O2 and a molecular weight of 414.50 g/mol. Its IUPAC name is (3aR,10aS)-8-(2,4-difluorophenyl)-2-hexyl-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one.
| Compound Name | (3aR,10aS)-8-(2,4-difluorophenyl)-2-hexyl-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 125418330 |
| Molecular Formula | C24H28F2N2O2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (3aR,10aS)-8-(2,4-difluorophenyl)-2-hexyl-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
| SMILES | CCCCCCN1C[C@@H]2Oc3cc(-c4ccc(F)cc4F)ccc3C(=O)N(C)[C@@H]2C1 |
| InChI | InChI=1S/C24H28F2N2O2/c1-3-4-5-6-11-28-14-21-23(15-28)30-22-12-16(7-9-19(22)24(29)27(21)2)18-10-8-17(25)13-20(18)26/h7-10,12-13,21,23H,3-6,11,14-15H2,1-2H3/t21-,23+/m1/s1 |
| InChIKey | QROGGVHHKYJECS-GGAORHGYSA-N |
| XLogP | 4.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|