C26H25ClN2O3 — CID 125418471
(3aR,10aS)-2-[(2-chlorophenyl)methyl]-8-(3-methoxyphenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one (PubChem CID 125418471) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is (3aR,10aS)-2-[(2-chlorophenyl)methyl]-8-(3-methoxyphenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one.
| Compound Name | (3aR,10aS)-2-[(2-chlorophenyl)methyl]-8-(3-methoxyphenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 125418471 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3aR,10aS)-2-[(2-chlorophenyl)methyl]-8-(3-methoxyphenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
| SMILES | COc1cccc(-c2ccc3c(c2)O[C@H]2CN(Cc4ccccc4Cl)C[C@H]2N(C)C3=O)c1 |
| InChI | InChI=1S/C26H25ClN2O3/c1-28-23-15-29(14-19-6-3-4-9-22(19)27)16-25(23)32-24-13-18(10-11-21(24)26(28)30)17-7-5-8-20(12-17)31-2/h3-13,23,25H,14-16H2,1-2H3/t23-,25+/m1/s1 |
| InChIKey | SJDKBSVTMCBTLW-NOZRDPDXSA-N |
| XLogP | 4.73 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |