C23H22F2N4O2 — CID 125418532
(3aR,10aS)-8-(2,4-difluorophenyl)-4-methyl-2-[(1-methylimidazol-2-yl)methyl]-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one (PubChem CID 125418532) has the molecular formula C23H22F2N4O2 and a molecular weight of 424.45 g/mol. Its IUPAC name is (3aR,10aS)-8-(2,4-difluorophenyl)-4-methyl-2-[(1-methylimidazol-2-yl)methyl]-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one.
| Compound Name | (3aR,10aS)-8-(2,4-difluorophenyl)-4-methyl-2-[(1-methylimidazol-2-yl)methyl]-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 125418532 |
| Molecular Formula | C23H22F2N4O2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3aR,10aS)-8-(2,4-difluorophenyl)-4-methyl-2-[(1-methylimidazol-2-yl)methyl]-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
| SMILES | CN1C(=O)c2ccc(-c3ccc(F)cc3F)cc2O[C@H]2CN(Cc3nccn3C)C[C@H]21 |
| InChI | InChI=1S/C23H22F2N4O2/c1-27-8-7-26-22(27)13-29-11-19-21(12-29)31-20-9-14(3-5-17(20)23(30)28(19)2)16-6-4-15(24)10-18(16)25/h3-10,19,21H,11-13H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | VATMPWZGCCXIGQ-CTNGQTDRSA-N |
| XLogP | 3.08 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |