About 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea
3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea (PubChem CID 125419894) has the molecular formula C13H16BrN3O2
and a molecular weight of 326.19 g/mol. Its IUPAC name is 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea |
| PubChem CID | 125419894 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1nc2ccc(Br)cc2o1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-3-17(4-2)13(18)15-8-12-16-10-6-5-9(14)7-11(10)19-12/h5-7H,3-4,8H2,1-2H3,(H,15,18) |
| InChIKey | QATZVSVIRQLZSH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea?
The IUPAC name of 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea (CID 125419894) is 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea.
What is the SMILES notation for 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea?
The canonical SMILES for 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea is CCN(CC)C(=O)NCc1nc2ccc(Br)cc2o1.
What is the InChIKey of 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea?
The InChIKey is QATZVSVIRQLZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN3O2/c1-3-17(4-2)13(18)15-8-12-16-10-6-5-9(14)7-11(10)19-12/h5-7H,3-4,8H2,1-2H3,(H,15,18).
What are the key properties of 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea?
3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea has a molecular weight of 326.19 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromo-1,3-benzoxazol-2-yl)methyl]-1,1-diethylurea is sourced from PubChem (CID 125419894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).