About 2-fluoroacetamide
2-fluoroacetamide (PubChem CID 12542) has the molecular formula C2H4FNO
and a molecular weight of 77.06 g/mol. Its IUPAC name is 2-fluoroacetamide.
Molecular Properties
| Compound Name | 2-fluoroacetamide |
| PubChem CID | 12542 |
| Molecular Formula | C2H4FNO |
| Molecular Weight | 77.06 g/mol |
| Exact Mass | 77.03 |
| IUPAC Name | 2-fluoroacetamide |
| SMILES | NC(=O)CF |
| InChI | InChI=1S/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | FVTWJXMFYOXOKK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.06 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetamide?
The IUPAC name of 2-fluoroacetamide (CID 12542) is 2-fluoroacetamide.
What is the SMILES notation for 2-fluoroacetamide?
The canonical SMILES for 2-fluoroacetamide is NC(=O)CF.
What is the InChIKey of 2-fluoroacetamide?
The InChIKey is FVTWJXMFYOXOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5).
What are the key properties of 2-fluoroacetamide?
2-fluoroacetamide has a molecular weight of 77.06 g/mol, XLogP of -0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetamide is sourced from PubChem (CID 12542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).